C14H26 — CID 91022928
1-methyl-4-(2,3,4-trimethylpentyl)cyclopentene (PubChem CID 91022928) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1-methyl-4-(2,3,4-trimethylpentyl)cyclopentene.
| Compound Name | 1-methyl-4-(2,3,4-trimethylpentyl)cyclopentene |
|---|---|
| PubChem CID | 91022928 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1-methyl-4-(2,3,4-trimethylpentyl)cyclopentene |
| SMILES | CC1=CCC(CC(C)C(C)C(C)C)C1 |
| InChI | InChI=1S/C14H26/c1-10(2)13(5)12(4)9-14-7-6-11(3)8-14/h6,10,12-14H,7-9H2,1-5H3 |
| InChIKey | WKEMISLOTKNQAG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|