C26H43NO2 — CID 123331515
(4-nonylphenyl) N-[(1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 123331515) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (4-nonylphenyl) N-[(1,3,3-trimethylcyclohexyl)methyl]carbamate.
| Compound Name | (4-nonylphenyl) N-[(1,3,3-trimethylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 123331515 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | (4-nonylphenyl) N-[(1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CCCCCCCCCc1ccc(OC(=O)NCC2(C)CCCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H43NO2/c1-5-6-7-8-9-10-11-13-22-14-16-23(17-15-22)29-24(28)27-21-26(4)19-12-18-25(2,3)20-26/h14-17H,5-13,18-21H2,1-4H3,(H,27,28) |
| InChIKey | ZWZQGRHZFYTPBQ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|