C15H18 — CID 123334051
5-(cyclohexen-1-yl)-2,3-dihydro-1H-indene (PubChem CID 123334051) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(cyclohexen-1-yl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 123334051 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-(cyclohexen-1-yl)-2,3-dihydro-1H-indene |
| SMILES | C1=C(c2ccc3c(c2)CCC3)CCCC1 |
| InChI | InChI=1S/C15H18/c1-2-5-12(6-3-1)15-10-9-13-7-4-8-14(13)11-15/h5,9-11H,1-4,6-8H2 |
| InChIKey | PCYALHMMHYTYTO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |