C5H9FN2 — CID 123335050
5-fluoro-1,2,3,6-tetrahydropyridin-2-amine (PubChem CID 123335050) has the molecular formula C5H9FN2 and a molecular weight of 116.14 g/mol. Its IUPAC name is 5-fluoro-1,2,3,6-tetrahydropyridin-2-amine.
| Compound Name | 5-fluoro-1,2,3,6-tetrahydropyridin-2-amine |
|---|---|
| PubChem CID | 123335050 |
| Molecular Formula | C5H9FN2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | 5-fluoro-1,2,3,6-tetrahydropyridin-2-amine |
| SMILES | NC1CC=C(F)CN1 |
| InChI | InChI=1S/C5H9FN2/c6-4-1-2-5(7)8-3-4/h1,5,8H,2-3,7H2 |
| InChIKey | ZBLMRKDAIRFSJK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |