C12H25NO4 — CID 123335095
4-(2-hydroxypropan-2-yloxy)-N-(3-hydroxypropyl)-3,3-dimethylbutanamide (PubChem CID 123335095) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is 4-(2-hydroxypropan-2-yloxy)-N-(3-hydroxypropyl)-3,3-dimethylbutanamide.
| Compound Name | 4-(2-hydroxypropan-2-yloxy)-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123335095 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 4-(2-hydroxypropan-2-yloxy)-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(COC(C)(C)O)CC(=O)NCCCO |
| InChI | InChI=1S/C12H25NO4/c1-11(2,9-17-12(3,4)16)8-10(15)13-6-5-7-14/h14,16H,5-9H2,1-4H3,(H,13,15) |
| InChIKey | PUUWOTKZDFZNHI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|