C24H14F5NO5S — CID 123335670
(2,3,4,5,6-pentafluorophenyl) 1-(4-ethenyl-2-methoxyphenyl)-2-oxoquinoline-6-sulfonate (PubChem CID 123335670) has the molecular formula C24H14F5NO5S and a molecular weight of 523.44 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-(4-ethenyl-2-methoxyphenyl)-2-oxoquinoline-6-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-(4-ethenyl-2-methoxyphenyl)-2-oxoquinoline-6-sulfonate |
|---|---|
| PubChem CID | 123335670 |
| Molecular Formula | C24H14F5NO5S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-(4-ethenyl-2-methoxyphenyl)-2-oxoquinoline-6-sulfonate |
| SMILES | C=Cc1ccc(-n2c(=O)ccc3cc(S(=O)(=O)Oc4c(F)c(F)c(F)c(F)c4F)ccc32)c(OC)c1 |
| InChI | InChI=1S/C24H14F5NO5S/c1-3-12-4-7-16(17(10-12)34-2)30-15-8-6-14(11-13(15)5-9-18(30)31)36(32,33)35-24-22(28)20(26)19(25)21(27)23(24)29/h3-11H,1H2,2H3 |
| InChIKey | XJANPBPOBJSYNA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|