C28H16F9NO5S — CID 162497818
(2,3,4,5,6-pentafluorophenyl) 1-[2-cyclopropyloxy-5-fluoro-4-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]phenyl]-2-oxoquinoline-6-sulfonate (PubChem CID 162497818) has the molecular formula C28H16F9NO5S and a molecular weight of 649.49 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-[2-cyclopropyloxy-5-fluoro-4-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]phenyl]-2-oxoquinoline-6-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-[2-cyclopropyloxy-5-fluoro-4-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]phenyl]-2-oxoquinoline-6-sulfonate |
|---|---|
| PubChem CID | 162497818 |
| Molecular Formula | C28H16F9NO5S |
| Molecular Weight | 649.49 g/mol |
| Exact Mass | 649.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-[2-cyclopropyloxy-5-fluoro-4-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]phenyl]-2-oxoquinoline-6-sulfonate |
| SMILES | O=c1ccc2cc(S(=O)(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc2n1-c1cc(F)c([C@H]2C[C@@H]2C(F)(F)F)cc1OC1CC1 |
| InChI | InChI=1S/C28H16F9NO5S/c29-17-10-19(20(42-12-2-3-12)9-15(17)14-8-16(14)28(35,36)37)38-18-5-4-13(7-11(18)1-6-21(38)39)44(40,41)43-27-25(33)23(31)22(30)24(32)26(27)34/h1,4-7,9-10,12,14,16H,2-3,8H2/t14-,16+/m1/s1 |
| InChIKey | WONZHZUBTMUECG-ZBFHGGJFSA-N |
| XLogP | 6.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|