C39H43FO9 — CID 123336551
(4aR,5aR,12aR)-2-acetyl-9-[3-(3-acetyl-4-fluorophenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123336551) has the molecular formula C39H43FO9 and a molecular weight of 674.76 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-9-[3-(3-acetyl-4-fluorophenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-9-[3-(3-acetyl-4-fluorophenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123336551 |
| Molecular Formula | C39H43FO9 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-9-[3-(3-acetyl-4-fluorophenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)c1cc(CC(=O)Cc2cc(C(C)C)c3c(c2O)C(=O)C2C(=O)[C@@]4(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]4(C)C[C@@]2(C)C3)ccc1F |
| InChI | InChI=1S/C39H43FO9/c1-17(2)24-14-22(13-23(43)11-21-9-10-27(40)25(12-21)19(5)41)32(44)29-26(24)15-37(7)16-38(8)30(18(3)4)33(45)28(20(6)42)35(47)39(38,49)36(48)31(37)34(29)46/h9-10,12,14,17-18,28,30-31,44,49H,11,13,15-16H2,1-8H3/t28?,30?,31?,37-,38-,39+/m1/s1 |
| InChIKey | RUANYIVSHCZNRY-CZHPUPTFSA-N |
| XLogP | 4.91 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|