C26H23ClFN5O2 — CID 123336781
1-(4-chlorophenyl)-3-[4-fluoro-3-[(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]urea (PubChem CID 123336781) has the molecular formula C26H23ClFN5O2 and a molecular weight of 491.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-fluoro-3-[(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-fluoro-3-[(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 123336781 |
| Molecular Formula | C26H23ClFN5O2 |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-fluoro-3-[(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(F)c(Cc2ccc3ncc(N4CCOCC4)nc3c2)c1 |
| InChI | InChI=1S/C26H23ClFN5O2/c27-19-2-4-20(5-3-19)30-26(34)31-21-6-7-22(28)18(15-21)13-17-1-8-23-24(14-17)32-25(16-29-23)33-9-11-35-12-10-33/h1-8,14-16H,9-13H2,(H2,30,31,34) |
| InChIKey | NWRQXRQOUCASLX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |