C26H36N5O5+ — CID 123337731
2-(3-amino-6-ethoxy-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]phthalazin-2-ium-2-yl)-1-[3-tert-butyl-5-(2-hydroxyethoxy)-4-methoxyphenyl]ethanone (PubChem CID 123337731) has the molecular formula C26H36N5O5+ and a molecular weight of 498.60 g/mol. Its IUPAC name is 2-(3-amino-6-ethoxy-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]phthalazin-2-ium-2-yl)-1-[3-tert-butyl-5-(2-hydroxyethoxy)-4-methoxyphenyl]ethanone.
| Compound Name | 2-(3-amino-6-ethoxy-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]phthalazin-2-ium-2-yl)-1-[3-tert-butyl-5-(2-hydroxyethoxy)-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 123337731 |
| Molecular Formula | C26H36N5O5+ |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-(3-amino-6-ethoxy-7,8,9,10-tetrahydro-[1,2,4]triazolo[3,4-a]phthalazin-2-ium-2-yl)-1-[3-tert-butyl-5-(2-hydroxyethoxy)-4-methoxyphenyl]ethanone |
| SMILES | CCOc1nn2c(N)[n+](CC(=O)c3cc(OCCO)c(OC)c(C(C)(C)C)c3)nc2c2c1CCCC2 |
| InChI | InChI=1S/C26H35N5O5/c1-6-35-24-18-10-8-7-9-17(18)23-28-30(25(27)31(23)29-24)15-20(33)16-13-19(26(2,3)4)22(34-5)21(14-16)36-12-11-32/h13-14,27,32H,6-12,15H2,1-5H3/p+1 |
| InChIKey | FNHQPGWTKRWBTB-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|