C27H40N5O4+ — CID 123454496
2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(4-hydroxybutoxy)phenyl]ethanone (PubChem CID 123454496) has the molecular formula C27H40N5O4+ and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(4-hydroxybutoxy)phenyl]ethanone.
| Compound Name | 2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(4-hydroxybutoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 123454496 |
| Molecular Formula | C27H40N5O4+ |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(4-hydroxybutoxy)phenyl]ethanone |
| SMILES | CCCCCOc1cc(C)c2n[n+](CC(=O)c3cc(OCCCCO)cc(C(C)(C)C)c3)c(N)n2n1 |
| InChI | InChI=1S/C27H39N5O4/c1-6-7-9-13-36-24-14-19(2)25-30-31(26(28)32(25)29-24)18-23(34)20-15-21(27(3,4)5)17-22(16-20)35-12-10-8-11-33/h14-17,28,33H,6-13,18H2,1-5H3/p+1 |
| InChIKey | LQKWEYIOVGISRX-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|