C27H38N5O4+ — CID 91094001
2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]ethanone (PubChem CID 91094001) has the molecular formula C27H38N5O4+ and a molecular weight of 496.63 g/mol. Its IUPAC name is 2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]ethanone.
| Compound Name | 2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 91094001 |
| Molecular Formula | C27H38N5O4+ |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]ethanone |
| SMILES | CCCCCOc1ccc2n[n+](CC(=O)c3cc(OCC)cc(OCC4CCCCC4)c3)c(N)n2n1 |
| InChI | InChI=1S/C27H37N5O4/c1-3-5-9-14-35-26-13-12-25-29-31(27(28)32(25)30-26)18-24(33)21-15-22(34-4-2)17-23(16-21)36-19-20-10-7-6-8-11-20/h12-13,15-17,20,28H,3-11,14,18-19H2,1-2H3/p+1 |
| InChIKey | WBMBTEJXQVEBQF-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|