C26H38N5O4+ — CID 123705842
2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(3-hydroxypropoxy)phenyl]ethanone (PubChem CID 123705842) has the molecular formula C26H38N5O4+ and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(3-hydroxypropoxy)phenyl]ethanone.
| Compound Name | 2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(3-hydroxypropoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 123705842 |
| Molecular Formula | C26H38N5O4+ |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 2-(3-amino-8-methyl-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-2-ium-2-yl)-1-[3-tert-butyl-5-(3-hydroxypropoxy)phenyl]ethanone |
| SMILES | CCCCCOc1cc(C)c2n[n+](CC(=O)c3cc(OCCCO)cc(C(C)(C)C)c3)c(N)n2n1 |
| InChI | InChI=1S/C26H37N5O4/c1-6-7-8-11-35-23-13-18(2)24-29-30(25(27)31(24)28-23)17-22(33)19-14-20(26(3,4)5)16-21(15-19)34-12-9-10-32/h13-16,27,32H,6-12,17H2,1-5H3/p+1 |
| InChIKey | SYIAGQLTPYIVFT-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|