C23H31ClN6O4 — CID 66941578
2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,N,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide;hydrochloride (PubChem CID 66941578) has the molecular formula C23H31ClN6O4 and a molecular weight of 490.99 g/mol. Its IUPAC name is 2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,N,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide;hydrochloride.
| Compound Name | 2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,N,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 66941578 |
| Molecular Formula | C23H31ClN6O4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,N,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=c1\n(CC(=O)c2cc(OCCO)cc(C(C)(C)C)c2)nc2c(C)cc(C(=O)N(C)C)nn12 |
| InChI | InChI=1S/C23H30N6O4.ClH/c1-14-9-18(21(32)27(5)6)25-29-20(14)26-28(22(29)24)13-19(31)15-10-16(23(2,3)4)12-17(11-15)33-8-7-30;/h9-12,24,30H,7-8,13H2,1-6H3;1H/b24-22+; |
| InChIKey | VKDZYGGWIVSOFP-HDPAMLMOSA-N |
| XLogP | 1.99 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |