C24H30F3N5O3 — CID 58136878
1-[3-tert-butyl-5-(3,3,3-trifluoropropoxy)phenyl]-2-(6-ethoxy-3-imino-7,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)ethanone (PubChem CID 58136878) has the molecular formula C24H30F3N5O3 and a molecular weight of 493.53 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-(3,3,3-trifluoropropoxy)phenyl]-2-(6-ethoxy-3-imino-7,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)ethanone.
| Compound Name | 1-[3-tert-butyl-5-(3,3,3-trifluoropropoxy)phenyl]-2-(6-ethoxy-3-imino-7,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)ethanone |
|---|---|
| PubChem CID | 58136878 |
| Molecular Formula | C24H30F3N5O3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 1-[3-tert-butyl-5-(3,3,3-trifluoropropoxy)phenyl]-2-(6-ethoxy-3-imino-7,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)ethanone |
| SMILES | [H]/N=c1\n(CC(=O)c2cc(OCCC(F)(F)F)cc(C(C)(C)C)c2)nc2c(C)c(C)c(OCC)nn12 |
| InChI | InChI=1S/C24H30F3N5O3/c1-7-34-21-15(3)14(2)20-29-31(22(28)32(20)30-21)13-19(33)16-10-17(23(4,5)6)12-18(11-16)35-9-8-24(25,26)27/h10-12,28H,7-9,13H2,1-6H3/b28-22+ |
| InChIKey | WKLOHETWXISCEH-XAYXJRQQSA-N |
| XLogP | 4.54 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |