C26H38ClN5O3 — CID 87209939
2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(propoxymethyl)phenyl]ethanone chloride (PubChem CID 87209939) has the molecular formula C26H38ClN5O3 and a molecular weight of 504.08 g/mol. Its IUPAC name is 2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(propoxymethyl)phenyl]ethanone chloride.
| Compound Name | 2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(propoxymethyl)phenyl]ethanone chloride |
|---|---|
| PubChem CID | 87209939 |
| Molecular Formula | C26H38ClN5O3 |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(propoxymethyl)phenyl]ethanone chloride |
| SMILES | CCCOCc1cc(C(=O)C[n+]2nc(N)n3nc(OC(CC)CC)ccc32)cc(C(C)(C)C)c1.[Cl-] |
| InChI | InChI=1S/C26H38N5O3.ClH/c1-7-12-33-17-18-13-19(15-20(14-18)26(4,5)6)22(32)16-30-24-11-10-23(34-21(8-2)9-3)28-31(24)25(27)29-30;/h10-11,13-15,21H,7-9,12,16-17H2,1-6H3,(H2,27,29);1H/q+1;/p-1 |
| InChIKey | ITEYYDFKVDMSOB-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|