C25H36ClN5O4 — CID 87209888
2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(2-methoxyethoxy)phenyl]ethanone chloride (PubChem CID 87209888) has the molecular formula C25H36ClN5O4 and a molecular weight of 506.05 g/mol. Its IUPAC name is 2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(2-methoxyethoxy)phenyl]ethanone chloride.
| Compound Name | 2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(2-methoxyethoxy)phenyl]ethanone chloride |
|---|---|
| PubChem CID | 87209888 |
| Molecular Formula | C25H36ClN5O4 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-(3-amino-6-pentan-3-yloxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-[3-tert-butyl-5-(2-methoxyethoxy)phenyl]ethanone chloride |
| SMILES | CCC(CC)Oc1ccc2n(n1)c(N)n[n+]2CC(=O)c1cc(OCCOC)cc(C(C)(C)C)c1.[Cl-] |
| InChI | InChI=1S/C25H36N5O4.ClH/c1-7-19(8-2)34-22-9-10-23-29(28-24(26)30(23)27-22)16-21(31)17-13-18(25(3,4)5)15-20(14-17)33-12-11-32-6;/h9-10,13-15,19H,7-8,11-12,16H2,1-6H3,(H2,26,28);1H/q+1;/p-1 |
| InChIKey | PVSFEONINNZRRE-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|