C20H25ClN5O4+ — CID 91259409
2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanone (PubChem CID 91259409) has the molecular formula C20H25ClN5O4+ and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanone.
| Compound Name | 2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 91259409 |
| Molecular Formula | C20H25ClN5O4+ |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(3-amino-6-pentoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanone |
| SMILES | CCCCCOc1ccc2n(n1)c(N)n[n+]2CC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25ClN5O4/c1-4-5-6-9-30-17-7-8-18-25(24-20(22)26(18)23-17)12-15(27)13-10-14(21)19(29-3)16(11-13)28-2/h7-8,10-11H,4-6,9,12H2,1-3H3,(H2,22,24)/q+1 |
| InChIKey | GTHUXAFJSSAKNK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|