C12H27N3 — CID 123337805
4-N,2,5-trimethyl-4-N-(2-methyliminoethyl)hexane-2,4-diamine (PubChem CID 123337805) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 4-N,2,5-trimethyl-4-N-(2-methyliminoethyl)hexane-2,4-diamine.
| Compound Name | 4-N,2,5-trimethyl-4-N-(2-methyliminoethyl)hexane-2,4-diamine |
|---|---|
| PubChem CID | 123337805 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 4-N,2,5-trimethyl-4-N-(2-methyliminoethyl)hexane-2,4-diamine |
| SMILES | C/N=C/CN(C)C(CC(C)(C)N)C(C)C |
| InChI | InChI=1S/C12H27N3/c1-10(2)11(9-12(3,4)13)15(6)8-7-14-5/h7,10-11H,8-9,13H2,1-6H3/b14-7+ |
| InChIKey | CEEKCPKTFGAROW-VGOFMYFVSA-N |
| XLogP | 1.77 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|