C10H9Cl3FNO — CID 123338382
3-fluoro-N-methoxy-1-(2,4,6-trichlorophenyl)prop-1-en-2-amine (PubChem CID 123338382) has the molecular formula C10H9Cl3FNO and a molecular weight of 284.55 g/mol. Its IUPAC name is 3-fluoro-N-methoxy-1-(2,4,6-trichlorophenyl)prop-1-en-2-amine.
| Compound Name | 3-fluoro-N-methoxy-1-(2,4,6-trichlorophenyl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 123338382 |
| Molecular Formula | C10H9Cl3FNO |
| Molecular Weight | 284.55 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 3-fluoro-N-methoxy-1-(2,4,6-trichlorophenyl)prop-1-en-2-amine |
| SMILES | CONC(=Cc1c(Cl)cc(Cl)cc1Cl)CF |
| InChI | InChI=1S/C10H9Cl3FNO/c1-16-15-7(5-14)4-8-9(12)2-6(11)3-10(8)13/h2-4,15H,5H2,1H3 |
| InChIKey | OCYPULIDQKJRGV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|