C10H10Cl2FNO — CID 123523452
1-(2,4-dichlorophenyl)-3-fluoro-N-methoxyprop-1-en-2-amine (PubChem CID 123523452) has the molecular formula C10H10Cl2FNO and a molecular weight of 250.10 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-fluoro-N-methoxyprop-1-en-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-3-fluoro-N-methoxyprop-1-en-2-amine |
|---|---|
| PubChem CID | 123523452 |
| Molecular Formula | C10H10Cl2FNO |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-fluoro-N-methoxyprop-1-en-2-amine |
| SMILES | CONC(=Cc1ccc(Cl)cc1Cl)CF |
| InChI | InChI=1S/C10H10Cl2FNO/c1-15-14-9(6-13)4-7-2-3-8(11)5-10(7)12/h2-5,14H,6H2,1H3 |
| InChIKey | KNCOMHNFGONZCD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|