C23H30ClN3 — CID 123338850
15-chloro-3-ethyl-5,11-dimethyl-8-piperazin-1-yl-6-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),5,8,13,15-hexaene (PubChem CID 123338850) has the molecular formula C23H30ClN3 and a molecular weight of 383.97 g/mol. Its IUPAC name is 15-chloro-3-ethyl-5,11-dimethyl-8-piperazin-1-yl-6-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),5,8,13,15-hexaene.
| Compound Name | 15-chloro-3-ethyl-5,11-dimethyl-8-piperazin-1-yl-6-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),5,8,13,15-hexaene |
|---|---|
| PubChem CID | 123338850 |
| Molecular Formula | C23H30ClN3 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 15-chloro-3-ethyl-5,11-dimethyl-8-piperazin-1-yl-6-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),5,8,13,15-hexaene |
| SMILES | CCC1CC(C)=NC2=C1c1cc(Cl)ccc1C(C)CC=C2N1CCNCC1 |
| InChI | InChI=1S/C23H30ClN3/c1-4-17-13-16(3)26-23-21(27-11-9-25-10-12-27)8-5-15(2)19-7-6-18(24)14-20(19)22(17)23/h6-8,14-15,17,25H,4-5,9-13H2,1-3H3 |
| InChIKey | MPQCUCJVGAGNSL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |