C31H42ClNO3 — CID 123358998
tert-butyl 2-[1-(15-chloro-5-ethyl-11-methyl-4-oxatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,8,13,15-hexaen-8-yl)azepan-4-yl]propanoate (PubChem CID 123358998) has the molecular formula C31H42ClNO3 and a molecular weight of 512.13 g/mol. Its IUPAC name is tert-butyl 2-[1-(15-chloro-5-ethyl-11-methyl-4-oxatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,8,13,15-hexaen-8-yl)azepan-4-yl]propanoate.
| Compound Name | tert-butyl 2-[1-(15-chloro-5-ethyl-11-methyl-4-oxatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,8,13,15-hexaen-8-yl)azepan-4-yl]propanoate |
|---|---|
| PubChem CID | 123358998 |
| Molecular Formula | C31H42ClNO3 |
| Molecular Weight | 512.13 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | tert-butyl 2-[1-(15-chloro-5-ethyl-11-methyl-4-oxatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,8,13,15-hexaen-8-yl)azepan-4-yl]propanoate |
| SMILES | CCC1C=C2C(=CO1)c1cc(Cl)ccc1C(C)CC=C2N1CCCC(C(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H42ClNO3/c1-7-24-18-27-28(19-35-24)26-17-23(32)11-12-25(26)20(2)10-13-29(27)33-15-8-9-22(14-16-33)21(3)30(34)36-31(4,5)6/h11-13,17-22,24H,7-10,14-16H2,1-6H3 |
| InChIKey | FSUMOWHMFJEFHM-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.13 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |