C44H65N9O3 — CID 123339570
2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]ethyl]carbamate (PubChem CID 123339570) has the molecular formula C44H65N9O3 and a molecular weight of 768.06 g/mol. Its IUPAC name is 2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]ethyl]carbamate.
| Compound Name | 2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 123339570 |
| Molecular Formula | C44H65N9O3 |
| Molecular Weight | 768.06 g/mol |
| Exact Mass | 767.52 |
| IUPAC Name | 2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]ethyl]carbamate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCNCCNC(=O)OCC(CC)Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C44H65N9O3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-28-39(54)46-31-29-45-30-32-47-44(55)56-34-38(6-2)50-43-51-41(48-33-37-26-23-22-24-27-37)40-42(52-43)53(35-49-40)36(3)4/h7-8,10-11,13-14,16-17,19-20,22-24,26-27,35-36,38,45H,5-6,9,12,15,18,21,25,28-34H2,1-4H3,(H,46,54)(H,47,55)(H2,48,50,51,52) |
| InChIKey | WYUACQOCIVQFBF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.06 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|