C27H33ClFN5O2Si — CID 123341287
[5-(6-chloro-3-pyridinyl)-2-fluoro-3-pyridinyl]-[4-methoxy-7-tri(propan-2-yl)silylpyrrolo[2,3-d]pyrimidin-5-yl]methanol (PubChem CID 123341287) has the molecular formula C27H33ClFN5O2Si and a molecular weight of 542.13 g/mol. Its IUPAC name is [5-(6-chloro-3-pyridinyl)-2-fluoro-3-pyridinyl]-[4-methoxy-7-tri(propan-2-yl)silylpyrrolo[2,3-d]pyrimidin-5-yl]methanol.
| Compound Name | [5-(6-chloro-3-pyridinyl)-2-fluoro-3-pyridinyl]-[4-methoxy-7-tri(propan-2-yl)silylpyrrolo[2,3-d]pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 123341287 |
| Molecular Formula | C27H33ClFN5O2Si |
| Molecular Weight | 542.13 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | [5-(6-chloro-3-pyridinyl)-2-fluoro-3-pyridinyl]-[4-methoxy-7-tri(propan-2-yl)silylpyrrolo[2,3-d]pyrimidin-5-yl]methanol |
| SMILES | COc1ncnc2c1c(C(O)c1cc(-c3ccc(Cl)nc3)cnc1F)cn2[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H33ClFN5O2Si/c1-15(2)37(16(3)4,17(5)6)34-13-21(23-26(34)32-14-33-27(23)36-7)24(35)20-10-19(12-31-25(20)29)18-8-9-22(28)30-11-18/h8-17,24,35H,1-7H3 |
| InChIKey | LLHMNHHKAJVPGI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.13 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|