C26H31N2+ — CID 123342916
5-tert-butyl-18,18-diethyl-8-aza-1-azoniapentacyclo[9.7.2.02,7.08,19.015,20]icosa-1(19),2(7),3,5,9,11(20),12,14-octaene (PubChem CID 123342916) has the molecular formula C26H31N2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is 5-tert-butyl-18,18-diethyl-8-aza-1-azoniapentacyclo[9.7.2.02,7.08,19.015,20]icosa-1(19),2(7),3,5,9,11(20),12,14-octaene.
| Compound Name | 5-tert-butyl-18,18-diethyl-8-aza-1-azoniapentacyclo[9.7.2.02,7.08,19.015,20]icosa-1(19),2(7),3,5,9,11(20),12,14-octaene |
|---|---|
| PubChem CID | 123342916 |
| Molecular Formula | C26H31N2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 5-tert-butyl-18,18-diethyl-8-aza-1-azoniapentacyclo[9.7.2.02,7.08,19.015,20]icosa-1(19),2(7),3,5,9,11(20),12,14-octaene |
| SMILES | CCC1(CC)CCc2cccc3ccn4c5cc(C(C)(C)C)ccc5[n+]1c4c23 |
| InChI | InChI=1S/C26H31N2/c1-6-26(7-2)15-13-18-9-8-10-19-14-16-27-22-17-20(25(3,4)5)11-12-21(22)28(26)24(27)23(18)19/h8-12,14,16-17H,6-7,13,15H2,1-5H3/q+1 |
| InChIKey | QDDXARJWHKMFLN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|