C24H22FN5S — CID 123343623
1-N-[7-(4-fluorobut-1-ynyl)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine (PubChem CID 123343623) has the molecular formula C24H22FN5S and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-N-[7-(4-fluorobut-1-ynyl)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine.
| Compound Name | 1-N-[7-(4-fluorobut-1-ynyl)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 123343623 |
| Molecular Formula | C24H22FN5S |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-N-[7-(4-fluorobut-1-ynyl)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine |
| SMILES | NC(CNc1nc(-c2ccncc2)nc2c(C#CCCF)csc12)Cc1ccccc1 |
| InChI | InChI=1S/C24H22FN5S/c25-11-5-4-8-19-16-31-22-21(19)29-23(18-9-12-27-13-10-18)30-24(22)28-15-20(26)14-17-6-2-1-3-7-17/h1-3,6-7,9-10,12-13,16,20H,5,11,14-15,26H2,(H,28,29,30) |
| InChIKey | JQPSWDRJYZDAOM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|