C26H27N5OS — CID 137426052
1-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]-3-methylpent-1-yn-3-ol (PubChem CID 137426052) has the molecular formula C26H27N5OS and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]-3-methylpent-1-yn-3-ol.
| Compound Name | 1-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]-3-methylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 137426052 |
| Molecular Formula | C26H27N5OS |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]-3-methylpent-1-yn-3-ol |
| SMILES | CCC(C)(O)C#Cc1csc2c(NC[C@@H](N)Cc3ccccc3)nc(-c3ccncc3)nc12 |
| InChI | InChI=1S/C26H27N5OS/c1-3-26(2,32)12-9-20-17-33-23-22(20)30-24(19-10-13-28-14-11-19)31-25(23)29-16-21(27)15-18-7-5-4-6-8-18/h4-8,10-11,13-14,17,21,32H,3,15-16,27H2,1-2H3,(H,29,30,31)/t21-,26?/m0/s1 |
| InChIKey | VJFNGKYYXWJZIE-GVNKFJBHSA-N |
| XLogP | 4.25 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|