C28H22FN5S — CID 118893247
1-[7-[2-(2-fluorophenyl)ethynyl]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine (PubChem CID 118893247) has the molecular formula C28H22FN5S and a molecular weight of 479.58 g/mol. Its IUPAC name is 1-[7-[2-(2-fluorophenyl)ethynyl]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine.
| Compound Name | 1-[7-[2-(2-fluorophenyl)ethynyl]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 118893247 |
| Molecular Formula | C28H22FN5S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-[7-[2-(2-fluorophenyl)ethynyl]-2-pyridin-4-ylthieno[3,2-d]pyrimidin-4-yl]-3-phenylpropane-1,2-diamine |
| SMILES | NC(Cc1ccccc1)C(N)c1nc(-c2ccncc2)nc2c(C#Cc3ccccc3F)csc12 |
| InChI | InChI=1S/C28H22FN5S/c29-22-9-5-4-8-19(22)10-11-21-17-35-27-25(21)33-28(20-12-14-32-15-13-20)34-26(27)24(31)23(30)16-18-6-2-1-3-7-18/h1-9,12-15,17,23-24H,16,30-31H2 |
| InChIKey | CMCCOTVYBRGFGQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|