C24H21FN4OS — CID 146240466
4-[2-(3-fluoro-4-pyridinyl)-4-(3-phenylpropylamino)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol (PubChem CID 146240466) has the molecular formula C24H21FN4OS and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-[2-(3-fluoro-4-pyridinyl)-4-(3-phenylpropylamino)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol.
| Compound Name | 4-[2-(3-fluoro-4-pyridinyl)-4-(3-phenylpropylamino)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 146240466 |
| Molecular Formula | C24H21FN4OS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[2-(3-fluoro-4-pyridinyl)-4-(3-phenylpropylamino)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol |
| SMILES | CC(O)C#Cc1csc2c(NCCCc3ccccc3)nc(-c3ccncc3F)nc12 |
| InChI | InChI=1S/C24H21FN4OS/c1-16(30)9-10-18-15-31-22-21(18)28-23(19-11-13-26-14-20(19)25)29-24(22)27-12-5-8-17-6-3-2-4-7-17/h2-4,6-7,11,13-16,30H,5,8,12H2,1H3,(H,27,28,29) |
| InChIKey | UOGAJZQBVVARBE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|