C26H26N4OS — CID 146240327
2-methyl-4-[6-methyl-4-(3-phenylpropylamino)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol (PubChem CID 146240327) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-methyl-4-[6-methyl-4-(3-phenylpropylamino)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[6-methyl-4-(3-phenylpropylamino)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 146240327 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-methyl-4-[6-methyl-4-(3-phenylpropylamino)-2-pyridin-4-ylthieno[3,2-d]pyrimidin-7-yl]but-3-yn-2-ol |
| SMILES | Cc1sc2c(NCCCc3ccccc3)nc(-c3ccncc3)nc2c1C#CC(C)(C)O |
| InChI | InChI=1S/C26H26N4OS/c1-18-21(11-14-26(2,3)31)22-23(32-18)25(28-15-7-10-19-8-5-4-6-9-19)30-24(29-22)20-12-16-27-17-13-20/h4-6,8-9,12-13,16-17,31H,7,10,15H2,1-3H3,(H,28,29,30) |
| InChIKey | GABSBQMLXUAFJT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|