C11H9N5S — CID 140658163
2-pyridin-4-ylthieno[3,2-d]pyrimidine-4,7-diamine (PubChem CID 140658163) has the molecular formula C11H9N5S and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-pyridin-4-ylthieno[3,2-d]pyrimidine-4,7-diamine.
| Compound Name | 2-pyridin-4-ylthieno[3,2-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 140658163 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-pyridin-4-ylthieno[3,2-d]pyrimidine-4,7-diamine |
| SMILES | Nc1csc2c(N)nc(-c3ccncc3)nc12 |
| InChI | InChI=1S/C11H9N5S/c12-7-5-17-9-8(7)15-11(16-10(9)13)6-1-3-14-4-2-6/h1-5H,12H2,(H2,13,15,16) |
| InChIKey | OIFGRUXOWYXSTQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |