C13H8IN5 — CID 149308070
2-iodo-4,6-dipyridin-4-yl-1,3,5-triazine (PubChem CID 149308070) has the molecular formula C13H8IN5 and a molecular weight of 361.15 g/mol. Its IUPAC name is 2-iodo-4,6-dipyridin-4-yl-1,3,5-triazine.
| Compound Name | 2-iodo-4,6-dipyridin-4-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 149308070 |
| Molecular Formula | C13H8IN5 |
| Molecular Weight | 361.15 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 2-iodo-4,6-dipyridin-4-yl-1,3,5-triazine |
| SMILES | Ic1nc(-c2ccncc2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C13H8IN5/c14-13-18-11(9-1-5-15-6-2-9)17-12(19-13)10-3-7-16-8-4-10/h1-8H |
| InChIKey | XYBLHFWWGSPMKG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|