C10H17ClO3 — CID 123344027
ethyl (4R,5R)-6-chloro-5-hydroxy-2,4-dimethylhex-2-enoate (PubChem CID 123344027) has the molecular formula C10H17ClO3 and a molecular weight of 220.70 g/mol. Its IUPAC name is ethyl (4R,5R)-6-chloro-5-hydroxy-2,4-dimethylhex-2-enoate.
| Compound Name | ethyl (4R,5R)-6-chloro-5-hydroxy-2,4-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 123344027 |
| Molecular Formula | C10H17ClO3 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | ethyl (4R,5R)-6-chloro-5-hydroxy-2,4-dimethylhex-2-enoate |
| SMILES | CCOC(=O)C(C)=C[C@@H](C)[C@@H](O)CCl |
| InChI | InChI=1S/C10H17ClO3/c1-4-14-10(13)8(3)5-7(2)9(12)6-11/h5,7,9,12H,4,6H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | QQLHLOKEIOCZGW-APPZFPTMSA-N |
| XLogP | 1.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|