C13H18Cl2O4 — CID 57079578
6-chloro-5-(5-chloro-2-methylpent-2-enoyl)oxy-2-methylhex-2-enoic acid (PubChem CID 57079578) has the molecular formula C13H18Cl2O4 and a molecular weight of 309.19 g/mol. Its IUPAC name is 6-chloro-5-(5-chloro-2-methylpent-2-enoyl)oxy-2-methylhex-2-enoic acid.
| Compound Name | 6-chloro-5-(5-chloro-2-methylpent-2-enoyl)oxy-2-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 57079578 |
| Molecular Formula | C13H18Cl2O4 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-chloro-5-(5-chloro-2-methylpent-2-enoyl)oxy-2-methylhex-2-enoic acid |
| SMILES | CC(=CCC(CCl)OC(=O)C(C)=CCCCl)C(=O)O |
| InChI | InChI=1S/C13H18Cl2O4/c1-9(12(16)17)5-6-11(8-15)19-13(18)10(2)4-3-7-14/h4-5,11H,3,6-8H2,1-2H3,(H,16,17) |
| InChIKey | XWAJRAURKDVCQH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|