C10H14Cl2O4 — CID 57318194
oxiran-2-ylmethyl 4,6-dichloro-5-hydroxy-2-methylhex-2-enoate (PubChem CID 57318194) has the molecular formula C10H14Cl2O4 and a molecular weight of 269.12 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4,6-dichloro-5-hydroxy-2-methylhex-2-enoate.
| Compound Name | oxiran-2-ylmethyl 4,6-dichloro-5-hydroxy-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 57318194 |
| Molecular Formula | C10H14Cl2O4 |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | oxiran-2-ylmethyl 4,6-dichloro-5-hydroxy-2-methylhex-2-enoate |
| SMILES | CC(=CC(Cl)C(O)CCl)C(=O)OCC1CO1 |
| InChI | InChI=1S/C10H14Cl2O4/c1-6(2-8(12)9(13)3-11)10(14)16-5-7-4-15-7/h2,7-9,13H,3-5H2,1H3 |
| InChIKey | FMCQEILGGTWDPB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|