C11H14F3NO4 — CID 123346666
2-(methoxycarbonylamino)-2-[3-(trifluoromethyl)-1-bicyclo[2.1.1]hexanyl]acetic acid (PubChem CID 123346666) has the molecular formula C11H14F3NO4 and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-(methoxycarbonylamino)-2-[3-(trifluoromethyl)-1-bicyclo[2.1.1]hexanyl]acetic acid.
| Compound Name | 2-(methoxycarbonylamino)-2-[3-(trifluoromethyl)-1-bicyclo[2.1.1]hexanyl]acetic acid |
|---|---|
| PubChem CID | 123346666 |
| Molecular Formula | C11H14F3NO4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-(methoxycarbonylamino)-2-[3-(trifluoromethyl)-1-bicyclo[2.1.1]hexanyl]acetic acid |
| SMILES | COC(=O)NC(C(=O)O)C12CC(C1)C(C(F)(F)F)C2 |
| InChI | InChI=1S/C11H14F3NO4/c1-19-9(18)15-7(8(16)17)10-2-5(3-10)6(4-10)11(12,13)14/h5-7H,2-4H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | USRKWFJVHIZBBN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |