C12H16F3NO4 — CID 123979037
2-(methoxycarbonylamino)-2-[4-(trifluoromethyl)-2-bicyclo[3.1.1]heptanyl]acetic acid (PubChem CID 123979037) has the molecular formula C12H16F3NO4 and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-(methoxycarbonylamino)-2-[4-(trifluoromethyl)-2-bicyclo[3.1.1]heptanyl]acetic acid.
| Compound Name | 2-(methoxycarbonylamino)-2-[4-(trifluoromethyl)-2-bicyclo[3.1.1]heptanyl]acetic acid |
|---|---|
| PubChem CID | 123979037 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(methoxycarbonylamino)-2-[4-(trifluoromethyl)-2-bicyclo[3.1.1]heptanyl]acetic acid |
| SMILES | COC(=O)NC(C(=O)O)C1CC(C(F)(F)F)C2CC1C2 |
| InChI | InChI=1S/C12H16F3NO4/c1-20-11(19)16-9(10(17)18)7-4-8(12(13,14)15)6-2-5(7)3-6/h5-9H,2-4H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | FAVISSOLKNNJDT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |