C21H36N2O3 — CID 123347497
tert-butyl N-[(3R)-1-[(2S,5R)-2-tert-butyl-5-ethenylpyrrolidin-1-yl]-3-methyl-1-oxopent-4-en-2-yl]carbamate (PubChem CID 123347497) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(2S,5R)-2-tert-butyl-5-ethenylpyrrolidin-1-yl]-3-methyl-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(2S,5R)-2-tert-butyl-5-ethenylpyrrolidin-1-yl]-3-methyl-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 123347497 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(2S,5R)-2-tert-butyl-5-ethenylpyrrolidin-1-yl]-3-methyl-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](C)C(NC(=O)OC(C)(C)C)C(=O)N1[C@H](C(C)(C)C)CC[C@@H]1C=C |
| InChI | InChI=1S/C21H36N2O3/c1-10-14(3)17(22-19(25)26-21(7,8)9)18(24)23-15(11-2)12-13-16(23)20(4,5)6/h10-11,14-17H,1-2,12-13H2,3-9H3,(H,22,25)/t14-,15+,16+,17?/m1/s1 |
| InChIKey | LPDQYOKKDSPGOK-WTYVYLTKSA-N |
| XLogP | 4.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|