C26H12O4S2 — CID 123351149
4,16-dithiaoctacyclo[16.6.2.26,13.02,17.03,15.05,14.07,12.019,24]octacosa-1,3(15),5,7,9,11,13,17,19,21,23,25,27-tridecaene-25,26,27,28-tetrol (PubChem CID 123351149) has the molecular formula C26H12O4S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 4,16-dithiaoctacyclo[16.6.2.26,13.02,17.03,15.05,14.07,12.019,24]octacosa-1,3(15),5,7,9,11,13,17,19,21,23,25,27-tridecaene-25,26,27,28-tetrol.
| Compound Name | 4,16-dithiaoctacyclo[16.6.2.26,13.02,17.03,15.05,14.07,12.019,24]octacosa-1,3(15),5,7,9,11,13,17,19,21,23,25,27-tridecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 123351149 |
| Molecular Formula | C26H12O4S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 4,16-dithiaoctacyclo[16.6.2.26,13.02,17.03,15.05,14.07,12.019,24]octacosa-1,3(15),5,7,9,11,13,17,19,21,23,25,27-tridecaene-25,26,27,28-tetrol |
| SMILES | Oc1c(O)c2c3ccccc3c1c1sc3c(sc4c5c(O)c(O)c(c6ccccc65)c34)c12 |
| InChI | InChI=1S/C26H12O4S2/c27-19-13-9-5-1-3-7-11(9)15(21(19)29)23-17(13)25-26(31-23)18-14-10-6-2-4-8-12(10)16(24(18)32-25)22(30)20(14)28/h1-8,27-30H |
| InChIKey | LZRDGUZJUQRJQD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|