C21H32O4 — CID 123351504
(1R)-1-[(1S,3aR,6S,7aS)-6-hydroxy-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethane-1,2-diol (PubChem CID 123351504) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R)-1-[(1S,3aR,6S,7aS)-6-hydroxy-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(1S,3aR,6S,7aS)-6-hydroxy-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 123351504 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R)-1-[(1S,3aR,6S,7aS)-6-hydroxy-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethane-1,2-diol |
| SMILES | CC1=C(C=CC2=C[C@@H](O)C[C@]3(C)[C@@H]([C@@H](O)CO)CC[C@@H]23)C[C@@H](O)CC1 |
| InChI | InChI=1S/C21H32O4/c1-13-3-6-16(23)9-14(13)4-5-15-10-17(24)11-21(2)18(15)7-8-19(21)20(25)12-22/h4-5,10,16-20,22-25H,3,6-9,11-12H2,1-2H3/t16-,17+,18-,19+,20-,21-/m0/s1 |
| InChIKey | OZRXILJOAKWPHZ-ZJKGHYPUSA-N |
| XLogP | 2.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |