C19H28O — CID 15558481
(1S)-3-[(E)-2-[(3aR,7aS)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol (PubChem CID 15558481) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1S)-3-[(E)-2-[(3aR,7aS)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol.
| Compound Name | (1S)-3-[(E)-2-[(3aR,7aS)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 15558481 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1S)-3-[(E)-2-[(3aR,7aS)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol |
| SMILES | CC1=C(/C=C/C2=CCC[C@]3(C)CCC[C@@H]23)C[C@@H](O)CC1 |
| InChI | InChI=1S/C19H28O/c1-14-7-10-17(20)13-16(14)9-8-15-5-3-11-19(2)12-4-6-18(15)19/h5,8-9,17-18,20H,3-4,6-7,10-13H2,1-2H3/b9-8+/t17-,18-,19+/m0/s1 |
| InChIKey | JNZORBOKUDFQCA-PEEKWUTASA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |