C20H28O2 — CID 20697601
3-[(E)-2-(1,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-4-yl)ethenyl]-5-hydroxy-2-methylcyclohex-2-en-1-one (PubChem CID 20697601) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 3-[(E)-2-(1,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-4-yl)ethenyl]-5-hydroxy-2-methylcyclohex-2-en-1-one.
| Compound Name | 3-[(E)-2-(1,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-4-yl)ethenyl]-5-hydroxy-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 20697601 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-[(E)-2-(1,7a-dimethyl-1,2,3,3a,6,7-hexahydroinden-4-yl)ethenyl]-5-hydroxy-2-methylcyclohex-2-en-1-one |
| SMILES | CC1=C(/C=C/C2=CCCC3(C)C(C)CCC23)CC(O)CC1=O |
| InChI | InChI=1S/C20H28O2/c1-13-6-9-18-15(5-4-10-20(13,18)3)7-8-16-11-17(21)12-19(22)14(16)2/h5,7-8,13,17-18,21H,4,6,9-12H2,1-3H3/b8-7+ |
| InChIKey | MUMFVNSZYNDPAW-BQYQJAHWSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |