C21H30O3 — CID 123142031
1-[(1S,3aR,7aS)-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-hydroxyethanone (PubChem CID 123142031) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(1S,3aR,7aS)-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S,3aR,7aS)-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 123142031 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[(1S,3aR,7aS)-4-[2-[(5S)-5-hydroxy-2-methylcyclohexen-1-yl]ethenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-hydroxyethanone |
| SMILES | CC1=C(C=CC2=CCC[C@]3(C)[C@@H](C(=O)CO)CC[C@@H]23)C[C@@H](O)CC1 |
| InChI | InChI=1S/C21H30O3/c1-14-5-8-17(23)12-16(14)7-6-15-4-3-11-21(2)18(15)9-10-19(21)20(24)13-22/h4,6-7,17-19,22-23H,3,5,8-13H2,1-2H3/t17-,18-,19+,21-/m0/s1 |
| InChIKey | QNACYKJZDWDDDG-HUUJSLGLSA-N |
| XLogP | 3.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |