C11H18O — CID 71388370
(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-ol (PubChem CID 71388370) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-ol.
| Compound Name | (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-ol |
|---|---|
| PubChem CID | 71388370 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-ol |
| SMILES | C[C@]12CCC=C(O)[C@H]1CCCC2 |
| InChI | InChI=1S/C11H18O/c1-11-7-3-2-5-9(11)10(12)6-4-8-11/h6,9,12H,2-5,7-8H2,1H3/t9-,11+/m1/s1 |
| InChIKey | MYYXDFGQGNFVOW-KOLCDFICSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |