C12H20Si — CID 173307881
1-(1,2-dimethylcyclohexyl)-1H-silole (PubChem CID 173307881) has the molecular formula C12H20Si and a molecular weight of 192.38 g/mol. Its IUPAC name is 1-(1,2-dimethylcyclohexyl)-1H-silole.
| Compound Name | 1-(1,2-dimethylcyclohexyl)-1H-silole |
|---|---|
| PubChem CID | 173307881 |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.38 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(1,2-dimethylcyclohexyl)-1H-silole |
| SMILES | CC1CCCCC1(C)[SiH]1C=CC=C1 |
| InChI | InChI=1S/C12H20Si/c1-11-7-3-4-8-12(11,2)13-9-5-6-10-13/h5-6,9-11,13H,3-4,7-8H2,1-2H3 |
| InChIKey | WSLZTMCQQXFCKY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|