C14H22 — CID 91595763
(3aR,7aS)-5,7a-dimethyl-4-prop-1-enyl-1,2,3,3a,6,7-hexahydroindene (PubChem CID 91595763) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3aR,7aS)-5,7a-dimethyl-4-prop-1-enyl-1,2,3,3a,6,7-hexahydroindene.
| Compound Name | (3aR,7aS)-5,7a-dimethyl-4-prop-1-enyl-1,2,3,3a,6,7-hexahydroindene |
|---|---|
| PubChem CID | 91595763 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3aR,7aS)-5,7a-dimethyl-4-prop-1-enyl-1,2,3,3a,6,7-hexahydroindene |
| SMILES | CC=CC1=C(C)CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C14H22/c1-4-6-12-11(2)8-10-14(3)9-5-7-13(12)14/h4,6,13H,5,7-10H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | QZERMPAJGVTXIN-KBPBESRZSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |