C17H19F2N5O — CID 123353013
[5-[(E)-C-ethyl-N-(methylideneamino)carbonimidoyl]-3,3-difluoropiperidin-1-yl]-imidazo[1,2-a]pyridin-2-ylmethanone (PubChem CID 123353013) has the molecular formula C17H19F2N5O and a molecular weight of 347.37 g/mol. Its IUPAC name is [5-[(E)-C-ethyl-N-(methylideneamino)carbonimidoyl]-3,3-difluoropiperidin-1-yl]-imidazo[1,2-a]pyridin-2-ylmethanone.
| Compound Name | [5-[(E)-C-ethyl-N-(methylideneamino)carbonimidoyl]-3,3-difluoropiperidin-1-yl]-imidazo[1,2-a]pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 123353013 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [5-[(E)-C-ethyl-N-(methylideneamino)carbonimidoyl]-3,3-difluoropiperidin-1-yl]-imidazo[1,2-a]pyridin-2-ylmethanone |
| SMILES | C=N/N=C(\CC)C1CN(C(=O)c2cn3ccccc3n2)CC(F)(F)C1 |
| InChI | InChI=1S/C17H19F2N5O/c1-3-13(22-20-2)12-8-17(18,19)11-24(9-12)16(25)14-10-23-7-5-4-6-15(23)21-14/h4-7,10,12H,2-3,8-9,11H2,1H3/b22-13+ |
| InChIKey | FAWBCADWLOORCB-LPYMAVHISA-N |
| XLogP | 2.90 |
| TPSA | 62.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|