C29H31F4N3O — CID 123353995
6-[2-[3-[2-[3-(2-fluoro-4-pyridinyl)propyl]-5-(trifluoromethyl)pyrimidin-4-yl]propyl]-5-methylphenyl]hex-1-en-3-one (PubChem CID 123353995) has the molecular formula C29H31F4N3O and a molecular weight of 513.58 g/mol. Its IUPAC name is 6-[2-[3-[2-[3-(2-fluoro-4-pyridinyl)propyl]-5-(trifluoromethyl)pyrimidin-4-yl]propyl]-5-methylphenyl]hex-1-en-3-one.
| Compound Name | 6-[2-[3-[2-[3-(2-fluoro-4-pyridinyl)propyl]-5-(trifluoromethyl)pyrimidin-4-yl]propyl]-5-methylphenyl]hex-1-en-3-one |
|---|---|
| PubChem CID | 123353995 |
| Molecular Formula | C29H31F4N3O |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 6-[2-[3-[2-[3-(2-fluoro-4-pyridinyl)propyl]-5-(trifluoromethyl)pyrimidin-4-yl]propyl]-5-methylphenyl]hex-1-en-3-one |
| SMILES | C=CC(=O)CCCc1cc(C)ccc1CCCc1nc(CCCc2ccnc(F)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C29H31F4N3O/c1-3-24(37)10-5-9-23-17-20(2)13-14-22(23)8-6-11-26-25(29(31,32)33)19-35-28(36-26)12-4-7-21-15-16-34-27(30)18-21/h3,13-19H,1,4-12H2,2H3 |
| InChIKey | QOEIZHVLDUNZHW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|