C13H27N — CID 123354922
N-tert-butyl-N-ethenyl-2,4-dimethylpentan-2-amine (PubChem CID 123354922) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N-tert-butyl-N-ethenyl-2,4-dimethylpentan-2-amine.
| Compound Name | N-tert-butyl-N-ethenyl-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 123354922 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-tert-butyl-N-ethenyl-2,4-dimethylpentan-2-amine |
| SMILES | C=CN(C(C)(C)C)C(C)(C)CC(C)C |
| InChI | InChI=1S/C13H27N/c1-9-14(12(4,5)6)13(7,8)10-11(2)3/h9,11H,1,10H2,2-8H3 |
| InChIKey | CBPSWHYLSWEBTL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |